C15H13FO3 — CID 63895819
1,3-benzodioxol-5-yl-(5-fluoro-2-methylphenyl)methanol (PubChem CID 63895819) has the molecular formula C15H13FO3 and a molecular weight of 260.26 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-(5-fluoro-2-methylphenyl)methanol.
| Compound Name | 1,3-benzodioxol-5-yl-(5-fluoro-2-methylphenyl)methanol |
|---|---|
| PubChem CID | 63895819 |
| Molecular Formula | C15H13FO3 |
| Molecular Weight | 260.26 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 1,3-benzodioxol-5-yl-(5-fluoro-2-methylphenyl)methanol |
| SMILES | Cc1ccc(F)cc1C(O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H13FO3/c1-9-2-4-11(16)7-12(9)15(17)10-3-5-13-14(6-10)19-8-18-13/h2-7,15,17H,8H2,1H3 |
| InChIKey | HIJJNTFQWJQOGI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.26 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |