C17H18ClFO — CID 63896005
1-(2-chloro-6-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanol (PubChem CID 63896005) has the molecular formula C17H18ClFO and a molecular weight of 292.78 g/mol. Its IUPAC name is 1-(2-chloro-6-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanol.
| Compound Name | 1-(2-chloro-6-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 63896005 |
| Molecular Formula | C17H18ClFO |
| Molecular Weight | 292.78 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 1-(2-chloro-6-fluorophenyl)-2-(2,4,6-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c(CC(O)c2c(F)cccc2Cl)c(C)c1 |
| InChI | InChI=1S/C17H18ClFO/c1-10-7-11(2)13(12(3)8-10)9-16(20)17-14(18)5-4-6-15(17)19/h4-8,16,20H,9H2,1-3H3 |
| InChIKey | SKBKHKVPVMROEJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.78 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |