C12H6F2N2S — CID 63896257
6-(3,4-difluorophenyl)-2-sulfanylidene-1H-pyridine-3-carbonitrile (PubChem CID 63896257) has the molecular formula C12H6F2N2S and a molecular weight of 248.26 g/mol. Its IUPAC name is 6-(3,4-difluorophenyl)-2-sulfanylidene-1H-pyridine-3-carbonitrile.
| Compound Name | 6-(3,4-difluorophenyl)-2-sulfanylidene-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 63896257 |
| Molecular Formula | C12H6F2N2S |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | 6-(3,4-difluorophenyl)-2-sulfanylidene-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(-c2ccc(F)c(F)c2)[nH]c1=S |
| InChI | InChI=1S/C12H6F2N2S/c13-9-3-1-7(5-10(9)14)11-4-2-8(6-15)12(17)16-11/h1-5H,(H,16,17) |
| InChIKey | OFWGQWRHZRBYGK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|