C14H28N4O3 — CID 63896583
2-[(1,4-dimethylpiperazin-2-yl)methylcarbamoylamino]hexanoic acid (PubChem CID 63896583) has the molecular formula C14H28N4O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-[(1,4-dimethylpiperazin-2-yl)methylcarbamoylamino]hexanoic acid.
| Compound Name | 2-[(1,4-dimethylpiperazin-2-yl)methylcarbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 63896583 |
| Molecular Formula | C14H28N4O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.22 |
| IUPAC Name | 2-[(1,4-dimethylpiperazin-2-yl)methylcarbamoylamino]hexanoic acid |
| SMILES | CCCCC(NC(=O)NCC1CN(C)CCN1C)C(=O)O |
| InChI | InChI=1S/C14H28N4O3/c1-4-5-6-12(13(19)20)16-14(21)15-9-11-10-17(2)7-8-18(11)3/h11-12H,4-10H2,1-3H3,(H,19,20)(H2,15,16,21) |
| InChIKey | HOMFYZLXJXSHGW-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |