About ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate
ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate (PubChem CID 63897736) has the molecular formula C10H12N2O5
and a molecular weight of 240.21 g/mol. Its IUPAC name is ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate.
Molecular Properties
| Compound Name | ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate |
| PubChem CID | 63897736 |
| Molecular Formula | C10H12N2O5 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate |
| SMILES | CCOC(=O)CC(=O)Cn1[nH]c(=O)ccc1=O |
| InChI | InChI=1S/C10H12N2O5/c1-2-17-10(16)5-7(13)6-12-9(15)4-3-8(14)11-12/h3-4H,2,5-6H2,1H3,(H,11,14) |
| InChIKey | XIKLWKIGOROIJD-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate?
The IUPAC name of ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate (CID 63897736) is ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate.
What is the SMILES notation for ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate?
The canonical SMILES for ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate is CCOC(=O)CC(=O)Cn1[nH]c(=O)ccc1=O.
What is the InChIKey of ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate?
The InChIKey is XIKLWKIGOROIJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O5/c1-2-17-10(16)5-7(13)6-12-9(15)4-3-8(14)11-12/h3-4H,2,5-6H2,1H3,(H,11,14).
What are the key properties of ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate?
ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate has a molecular weight of 240.21 g/mol, XLogP of -0.94, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3,6-dioxo-1H-pyridazin-2-yl)-3-oxobutanoate is sourced from PubChem (CID 63897736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).