C12H20IN3O — CID 63897992
1-(1,4-dimethylpiperazin-2-yl)-N-[(5-iodofuran-2-yl)methyl]methanamine (PubChem CID 63897992) has the molecular formula C12H20IN3O and a molecular weight of 349.22 g/mol. Its IUPAC name is 1-(1,4-dimethylpiperazin-2-yl)-N-[(5-iodofuran-2-yl)methyl]methanamine.
| Compound Name | 1-(1,4-dimethylpiperazin-2-yl)-N-[(5-iodofuran-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 63897992 |
| Molecular Formula | C12H20IN3O |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-(1,4-dimethylpiperazin-2-yl)-N-[(5-iodofuran-2-yl)methyl]methanamine |
| SMILES | CN1CCN(C)C(CNCc2ccc(I)o2)C1 |
| InChI | InChI=1S/C12H20IN3O/c1-15-5-6-16(2)10(9-15)7-14-8-11-3-4-12(13)17-11/h3-4,10,14H,5-9H2,1-2H3 |
| InChIKey | FFWYCPZZCSFQOT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 31.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|