C15H23N5 — CID 63898810
1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methylbenzimidazol-5-amine (PubChem CID 63898810) has the molecular formula C15H23N5 and a molecular weight of 273.38 g/mol. Its IUPAC name is 1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methylbenzimidazol-5-amine.
| Compound Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methylbenzimidazol-5-amine |
|---|---|
| PubChem CID | 63898810 |
| Molecular Formula | C15H23N5 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.20 |
| IUPAC Name | 1-[(1,4-dimethylpiperazin-2-yl)methyl]-2-methylbenzimidazol-5-amine |
| SMILES | Cc1nc2cc(N)ccc2n1CC1CN(C)CCN1C |
| InChI | InChI=1S/C15H23N5/c1-11-17-14-8-12(16)4-5-15(14)20(11)10-13-9-18(2)6-7-19(13)3/h4-5,8,13H,6-7,9-10,16H2,1-3H3 |
| InChIKey | NLJAARGOYUAVGG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|