C14H11Cl2FO — CID 63899311
(3,5-dichlorophenyl)-(4-fluoro-3-methylphenyl)methanol (PubChem CID 63899311) has the molecular formula C14H11Cl2FO and a molecular weight of 285.15 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-(4-fluoro-3-methylphenyl)methanol.
| Compound Name | (3,5-dichlorophenyl)-(4-fluoro-3-methylphenyl)methanol |
|---|---|
| PubChem CID | 63899311 |
| Molecular Formula | C14H11Cl2FO |
| Molecular Weight | 285.15 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | (3,5-dichlorophenyl)-(4-fluoro-3-methylphenyl)methanol |
| SMILES | Cc1cc(C(O)c2cc(Cl)cc(Cl)c2)ccc1F |
| InChI | InChI=1S/C14H11Cl2FO/c1-8-4-9(2-3-13(8)17)14(18)10-5-11(15)7-12(16)6-10/h2-7,14,18H,1H3 |
| InChIKey | QLLUQZNWOYKTFF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.15 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |