About 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol
3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol (PubChem CID 63899413) has the molecular formula C13H20F3NO
and a molecular weight of 263.30 g/mol. Its IUPAC name is 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol |
| PubChem CID | 63899413 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CNC12CC3CC(CC(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C13H20F3NO/c14-13(15,16)11(18)7-17-12-4-8-1-9(5-12)3-10(2-8)6-12/h8-11,17-18H,1-7H2 |
| InChIKey | ZUFUIHPVYDLUAZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol?
The IUPAC name of 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol (CID 63899413) is 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol.
What is the SMILES notation for 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol?
The canonical SMILES for 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol is OC(CNC12CC3CC(CC(C3)C1)C2)C(F)(F)F.
What is the InChIKey of 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol?
The InChIKey is ZUFUIHPVYDLUAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3NO/c14-13(15,16)11(18)7-17-12-4-8-1-9(5-12)3-10(2-8)6-12/h8-11,17-18H,1-7H2.
What are the key properties of 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol?
3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol has a molecular weight of 263.30 g/mol, XLogP of 2.47, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-adamantylamino)-1,1,1-trifluoropropan-2-ol is sourced from PubChem (CID 63899413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).