C13H17FO2 — CID 63899537
(5-fluoro-2-methylphenyl)-(oxan-3-yl)methanol (PubChem CID 63899537) has the molecular formula C13H17FO2 and a molecular weight of 224.27 g/mol. Its IUPAC name is (5-fluoro-2-methylphenyl)-(oxan-3-yl)methanol.
| Compound Name | (5-fluoro-2-methylphenyl)-(oxan-3-yl)methanol |
|---|---|
| PubChem CID | 63899537 |
| Molecular Formula | C13H17FO2 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | (5-fluoro-2-methylphenyl)-(oxan-3-yl)methanol |
| SMILES | Cc1ccc(F)cc1C(O)C1CCCOC1 |
| InChI | InChI=1S/C13H17FO2/c1-9-4-5-11(14)7-12(9)13(15)10-3-2-6-16-8-10/h4-5,7,10,13,15H,2-3,6,8H2,1H3 |
| InChIKey | VACIVGKLDQLTET-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |