C8H14F3NO3S — CID 63899631
3-[(1,1-dioxothian-4-yl)amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 63899631) has the molecular formula C8H14F3NO3S and a molecular weight of 261.26 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-4-yl)amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[(1,1-dioxothian-4-yl)amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 63899631 |
| Molecular Formula | C8H14F3NO3S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | 3-[(1,1-dioxothian-4-yl)amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | O=S1(=O)CCC(NCC(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C8H14F3NO3S/c9-8(10,11)7(13)5-12-6-1-3-16(14,15)4-2-6/h6-7,12-13H,1-5H2 |
| InChIKey | GPTVTJONHJPKTR-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |