About 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile
2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile (PubChem CID 63900182) has the molecular formula C7H8F3N3O
and a molecular weight of 207.15 g/mol. Its IUPAC name is 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile.
Molecular Properties
| Compound Name | 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile |
| PubChem CID | 63900182 |
| Molecular Formula | C7H8F3N3O |
| Molecular Weight | 207.15 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile |
| SMILES | N#CCN(CC#N)CC(O)C(F)(F)F |
| InChI | InChI=1S/C7H8F3N3O/c8-7(9,10)6(14)5-13(3-1-11)4-2-12/h6,14H,3-5H2 |
| InChIKey | JUDHBFDKCHDXCD-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 71.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.15 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|
Analyze 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile?
The IUPAC name of 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile (CID 63900182) is 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile.
What is the SMILES notation for 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile?
The canonical SMILES for 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile is N#CCN(CC#N)CC(O)C(F)(F)F.
What is the InChIKey of 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile?
The InChIKey is JUDHBFDKCHDXCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F3N3O/c8-7(9,10)6(14)5-13(3-1-11)4-2-12/h6,14H,3-5H2.
What are the key properties of 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile?
2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile has a molecular weight of 207.15 g/mol, XLogP of 0.26, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyanomethyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]acetonitrile is sourced from PubChem (CID 63900182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).