About 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol
2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol (PubChem CID 63900668) has the molecular formula C9H18F3NO2
and a molecular weight of 229.24 g/mol. Its IUPAC name is 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol.
Molecular Properties
| Compound Name | 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol |
| PubChem CID | 63900668 |
| Molecular Formula | C9H18F3NO2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol |
| SMILES | CCC(CC)(CO)NCC(O)C(F)(F)F |
| InChI | InChI=1S/C9H18F3NO2/c1-3-8(4-2,6-14)13-5-7(15)9(10,11)12/h7,13-15H,3-6H2,1-2H3 |
| InChIKey | ODWYWVIBOFYDMC-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol?
The IUPAC name of 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol (CID 63900668) is 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol.
What is the SMILES notation for 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol?
The canonical SMILES for 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol is CCC(CC)(CO)NCC(O)C(F)(F)F.
What is the InChIKey of 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol?
The InChIKey is ODWYWVIBOFYDMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18F3NO2/c1-3-8(4-2,6-14)13-5-7(15)9(10,11)12/h7,13-15H,3-6H2,1-2H3.
What are the key properties of 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol?
2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol has a molecular weight of 229.24 g/mol, XLogP of 1.05, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-2-[(3,3,3-trifluoro-2-hydroxypropyl)amino]butan-1-ol is sourced from PubChem (CID 63900668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).