About 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile
2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile (PubChem CID 63900674) has the molecular formula C7H11F3N2O
and a molecular weight of 196.17 g/mol. Its IUPAC name is 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile.
Molecular Properties
| Compound Name | 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile |
| PubChem CID | 63900674 |
| Molecular Formula | C7H11F3N2O |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile |
| SMILES | CC(C#N)N(C)CC(O)C(F)(F)F |
| InChI | InChI=1S/C7H11F3N2O/c1-5(3-11)12(2)4-6(13)7(8,9)10/h5-6,13H,4H2,1-2H3 |
| InChIKey | SMYOWCPKNNFETM-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile?
The IUPAC name of 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile (CID 63900674) is 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile.
What is the SMILES notation for 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile?
The canonical SMILES for 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile is CC(C#N)N(C)CC(O)C(F)(F)F.
What is the InChIKey of 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile?
The InChIKey is SMYOWCPKNNFETM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F3N2O/c1-5(3-11)12(2)4-6(13)7(8,9)10/h5-6,13H,4H2,1-2H3.
What are the key properties of 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile?
2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile has a molecular weight of 196.17 g/mol, XLogP of 0.75, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[methyl-(3,3,3-trifluoro-2-hydroxypropyl)amino]propanenitrile is sourced from PubChem (CID 63900674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).