C8H10F3N3O3 — CID 63901245
3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 63901245) has the molecular formula C8H10F3N3O3 and a molecular weight of 253.18 g/mol. Its IUPAC name is 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 63901245 |
| Molecular Formula | C8H10F3N3O3 |
| Molecular Weight | 253.18 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 3-(3,5-dimethyl-4-nitropyrazol-1-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | Cc1nn(CC(O)C(F)(F)F)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10F3N3O3/c1-4-7(14(16)17)5(2)13(12-4)3-6(15)8(9,10)11/h6,15H,3H2,1-2H3 |
| InChIKey | JIEACSLTQNEBNQ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|