C18H20N2O — CID 63901319
2,5-dimethyl-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)benzamide (PubChem CID 63901319) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 2,5-dimethyl-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)benzamide.
| Compound Name | 2,5-dimethyl-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)benzamide |
|---|---|
| PubChem CID | 63901319 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 2,5-dimethyl-N-(1,2,3,4-tetrahydroisoquinolin-7-yl)benzamide |
| SMILES | Cc1ccc(C)c(C(=O)Nc2ccc3c(c2)CNCC3)c1 |
| InChI | InChI=1S/C18H20N2O/c1-12-3-4-13(2)17(9-12)18(21)20-16-6-5-14-7-8-19-11-15(14)10-16/h3-6,9-10,19H,7-8,11H2,1-2H3,(H,20,21) |
| InChIKey | WIZKJPHBWHPZPR-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |