About N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide
N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide (PubChem CID 63901683) has the molecular formula C10H19F3N2O2
and a molecular weight of 256.27 g/mol. Its IUPAC name is N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide.
Molecular Properties
| Compound Name | N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide |
| PubChem CID | 63901683 |
| Molecular Formula | C10H19F3N2O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide |
| SMILES | CCC(C)NC(=O)CCNCC(O)C(F)(F)F |
| InChI | InChI=1S/C10H19F3N2O2/c1-3-7(2)15-9(17)4-5-14-6-8(16)10(11,12)13/h7-8,14,16H,3-6H2,1-2H3,(H,15,17) |
| InChIKey | QPOKGNSFFFUIRI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide?
The IUPAC name of N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide (CID 63901683) is N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide.
What is the SMILES notation for N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide?
The canonical SMILES for N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide is CCC(C)NC(=O)CCNCC(O)C(F)(F)F.
What is the InChIKey of N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide?
The InChIKey is QPOKGNSFFFUIRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19F3N2O2/c1-3-7(2)15-9(17)4-5-14-6-8(16)10(11,12)13/h7-8,14,16H,3-6H2,1-2H3,(H,15,17).
What are the key properties of N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide?
N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide has a molecular weight of 256.27 g/mol, XLogP of 0.80, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-3-[(3,3,3-trifluoro-2-hydroxypropyl)amino]propanamide is sourced from PubChem (CID 63901683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).