C11H20F3NO — CID 63902467
1,1,1-trifluoro-3-(4-propylpiperidin-1-yl)propan-2-ol (PubChem CID 63902467) has the molecular formula C11H20F3NO and a molecular weight of 239.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(4-propylpiperidin-1-yl)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-(4-propylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 63902467 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1,1,1-trifluoro-3-(4-propylpiperidin-1-yl)propan-2-ol |
| SMILES | CCCC1CCN(CC(O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H20F3NO/c1-2-3-9-4-6-15(7-5-9)8-10(16)11(12,13)14/h9-10,16H,2-8H2,1H3 |
| InChIKey | FHRCXHYMDFLICZ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |