C15H14N2O2S — CID 63902692
N-(1-benzothiophen-5-yl)-4-cyanooxane-4-carboxamide (PubChem CID 63902692) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is N-(1-benzothiophen-5-yl)-4-cyanooxane-4-carboxamide.
| Compound Name | N-(1-benzothiophen-5-yl)-4-cyanooxane-4-carboxamide |
|---|---|
| PubChem CID | 63902692 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | N-(1-benzothiophen-5-yl)-4-cyanooxane-4-carboxamide |
| SMILES | N#CC1(C(=O)Nc2ccc3sccc3c2)CCOCC1 |
| InChI | InChI=1S/C15H14N2O2S/c16-10-15(4-6-19-7-5-15)14(18)17-12-1-2-13-11(9-12)3-8-20-13/h1-3,8-9H,4-7H2,(H,17,18) |
| InChIKey | XLBVSKNHTZGUSO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |