C11H7Br2FN2O2S — CID 63903663
2,4-dibromo-N-(5-fluoro-2-pyridinyl)benzenesulfonamide (PubChem CID 63903663) has the molecular formula C11H7Br2FN2O2S and a molecular weight of 410.06 g/mol. Its IUPAC name is 2,4-dibromo-N-(5-fluoro-2-pyridinyl)benzenesulfonamide.
| Compound Name | 2,4-dibromo-N-(5-fluoro-2-pyridinyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63903663 |
| Molecular Formula | C11H7Br2FN2O2S |
| Molecular Weight | 410.06 g/mol |
| Exact Mass | 407.86 |
| IUPAC Name | 2,4-dibromo-N-(5-fluoro-2-pyridinyl)benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(F)cn1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H7Br2FN2O2S/c12-7-1-3-10(9(13)5-7)19(17,18)16-11-4-2-8(14)6-15-11/h1-6H,(H,15,16) |
| InChIKey | CNAJTACATJSOCH-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.06 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |