C16H32N2O2 — CID 63904485
N-(2-ethylhexyl)-3-piperidin-4-yloxypropanamide (PubChem CID 63904485) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is N-(2-ethylhexyl)-3-piperidin-4-yloxypropanamide.
| Compound Name | N-(2-ethylhexyl)-3-piperidin-4-yloxypropanamide |
|---|---|
| PubChem CID | 63904485 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | N-(2-ethylhexyl)-3-piperidin-4-yloxypropanamide |
| SMILES | CCCCC(CC)CNC(=O)CCOC1CCNCC1 |
| InChI | InChI=1S/C16H32N2O2/c1-3-5-6-14(4-2)13-18-16(19)9-12-20-15-7-10-17-11-8-15/h14-15,17H,3-13H2,1-2H3,(H,18,19) |
| InChIKey | DNWXNZJCVMORFN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |