C16H22N2S — CID 63905591
2-cyclopropyl-2-(ethylamino)-3-[(3-methylphenyl)methylsulfanyl]propanenitrile (PubChem CID 63905591) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-cyclopropyl-2-(ethylamino)-3-[(3-methylphenyl)methylsulfanyl]propanenitrile.
| Compound Name | 2-cyclopropyl-2-(ethylamino)-3-[(3-methylphenyl)methylsulfanyl]propanenitrile |
|---|---|
| PubChem CID | 63905591 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 2-cyclopropyl-2-(ethylamino)-3-[(3-methylphenyl)methylsulfanyl]propanenitrile |
| SMILES | CCNC(C#N)(CSCc1cccc(C)c1)C1CC1 |
| InChI | InChI=1S/C16H22N2S/c1-3-18-16(11-17,15-7-8-15)12-19-10-14-6-4-5-13(2)9-14/h4-6,9,15,18H,3,7-8,10,12H2,1-2H3 |
| InChIKey | ZCMGUPHPOZAYPC-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |