About 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile
2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile (PubChem CID 63906158) has the molecular formula C15H18F2N2S
and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile.
Molecular Properties
| Compound Name | 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile |
| PubChem CID | 63906158 |
| Molecular Formula | C15H18F2N2S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile |
| SMILES | CC(C)NC(C#N)(CSc1cc(F)ccc1F)C1CC1 |
| InChI | InChI=1S/C15H18F2N2S/c1-10(2)19-15(8-18,11-3-4-11)9-20-14-7-12(16)5-6-13(14)17/h5-7,10-11,19H,3-4,9H2,1-2H3 |
| InChIKey | UBUCQXVOSHETQJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile?
The IUPAC name of 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile (CID 63906158) is 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile.
What is the SMILES notation for 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile?
The canonical SMILES for 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile is CC(C)NC(C#N)(CSc1cc(F)ccc1F)C1CC1.
What is the InChIKey of 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile?
The InChIKey is UBUCQXVOSHETQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N2S/c1-10(2)19-15(8-18,11-3-4-11)9-20-14-7-12(16)5-6-13(14)17/h5-7,10-11,19H,3-4,9H2,1-2H3.
What are the key properties of 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile?
2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile has a molecular weight of 296.39 g/mol, XLogP of 3.73, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-3-(2,5-difluorophenyl)sulfanyl-2-(propan-2-ylamino)propanenitrile is sourced from PubChem (CID 63906158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).