About methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate
methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate (PubChem CID 63906853) has the molecular formula C16H30N2O3
and a molecular weight of 298.43 g/mol. Its IUPAC name is methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate.
Molecular Properties
| Compound Name | methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate |
| PubChem CID | 63906853 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate |
| SMILES | CCCNC(CN1CC(C)OC(C)C1)(C(=O)OC)C1CC1 |
| InChI | InChI=1S/C16H30N2O3/c1-5-8-17-16(14-6-7-14,15(19)20-4)11-18-9-12(2)21-13(3)10-18/h12-14,17H,5-11H2,1-4H3 |
| InChIKey | AEFOSUZIFGBNPK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate?
The IUPAC name of methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate (CID 63906853) is methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate.
What is the SMILES notation for methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate?
The canonical SMILES for methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate is CCCNC(CN1CC(C)OC(C)C1)(C(=O)OC)C1CC1.
What is the InChIKey of methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate?
The InChIKey is AEFOSUZIFGBNPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O3/c1-5-8-17-16(14-6-7-14,15(19)20-4)11-18-9-12(2)21-13(3)10-18/h12-14,17H,5-11H2,1-4H3.
What are the key properties of methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate?
methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate has a molecular weight of 298.43 g/mol, XLogP of 1.42, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyclopropyl-3-(2,6-dimethylmorpholin-4-yl)-2-(propylamino)propanoate is sourced from PubChem (CID 63906853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).