C13H26N2O2 — CID 63906980
methyl 2-amino-3-[butyl(ethyl)amino]-2-cyclopropylpropanoate (PubChem CID 63906980) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is methyl 2-amino-3-[butyl(ethyl)amino]-2-cyclopropylpropanoate.
| Compound Name | methyl 2-amino-3-[butyl(ethyl)amino]-2-cyclopropylpropanoate |
|---|---|
| PubChem CID | 63906980 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | methyl 2-amino-3-[butyl(ethyl)amino]-2-cyclopropylpropanoate |
| SMILES | CCCCN(CC)CC(N)(C(=O)OC)C1CC1 |
| InChI | InChI=1S/C13H26N2O2/c1-4-6-9-15(5-2)10-13(14,11-7-8-11)12(16)17-3/h11H,4-10,14H2,1-3H3 |
| InChIKey | IYHGYUMWHPYZSY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |