C12H21NO2 — CID 63907196
2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1-cyclopropylethanol (PubChem CID 63907196) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1-cyclopropylethanol.
| Compound Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1-cyclopropylethanol |
|---|---|
| PubChem CID | 63907196 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-1-cyclopropylethanol |
| SMILES | OC(CN1CCOC2CCCC21)C1CC1 |
| InChI | InChI=1S/C12H21NO2/c14-11(9-4-5-9)8-13-6-7-15-12-3-1-2-10(12)13/h9-12,14H,1-8H2 |
| InChIKey | LDMFMAYOABZNEZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |