About 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile
2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile (PubChem CID 63907382) has the molecular formula C15H18F2N2S
and a molecular weight of 296.39 g/mol. Its IUPAC name is 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile.
Molecular Properties
| Compound Name | 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile |
| PubChem CID | 63907382 |
| Molecular Formula | C15H18F2N2S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile |
| SMILES | CCCNC(C#N)(CSc1ccc(F)c(F)c1)C1CC1 |
| InChI | InChI=1S/C15H18F2N2S/c1-2-7-19-15(9-18,11-3-4-11)10-20-12-5-6-13(16)14(17)8-12/h5-6,8,11,19H,2-4,7,10H2,1H3 |
| InChIKey | CXXDMIDXSACJRW-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile?
The IUPAC name of 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile (CID 63907382) is 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile.
What is the SMILES notation for 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile?
The canonical SMILES for 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile is CCCNC(C#N)(CSc1ccc(F)c(F)c1)C1CC1.
What is the InChIKey of 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile?
The InChIKey is CXXDMIDXSACJRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18F2N2S/c1-2-7-19-15(9-18,11-3-4-11)10-20-12-5-6-13(16)14(17)8-12/h5-6,8,11,19H,2-4,7,10H2,1H3.
What are the key properties of 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile?
2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile has a molecular weight of 296.39 g/mol, XLogP of 3.73, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-3-(3,4-difluorophenyl)sulfanyl-2-(propylamino)propanenitrile is sourced from PubChem (CID 63907382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).