About 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine
2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine (PubChem CID 63908866) has the molecular formula C15H22N4
and a molecular weight of 258.37 g/mol. Its IUPAC name is 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine |
| PubChem CID | 63908866 |
| Molecular Formula | C15H22N4 |
| Molecular Weight | 258.37 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine |
| SMILES | Cc1cccn2cc(CN3C(C)CNCC3C)nc12 |
| InChI | InChI=1S/C15H22N4/c1-11-5-4-6-18-9-14(17-15(11)18)10-19-12(2)7-16-8-13(19)3/h4-6,9,12-13,16H,7-8,10H2,1-3H3 |
| InChIKey | LOIXFOSXOIWRDJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 32.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine?
The IUPAC name of 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine (CID 63908866) is 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine.
What is the SMILES notation for 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine?
The canonical SMILES for 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine is Cc1cccn2cc(CN3C(C)CNCC3C)nc12.
What is the InChIKey of 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine?
The InChIKey is LOIXFOSXOIWRDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N4/c1-11-5-4-6-18-9-14(17-15(11)18)10-19-12(2)7-16-8-13(19)3/h4-6,9,12-13,16H,7-8,10H2,1-3H3.
What are the key properties of 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine?
2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine has a molecular weight of 258.37 g/mol, XLogP of 1.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,6-dimethylpiperazin-1-yl)methyl]-8-methylimidazo[1,2-a]pyridine is sourced from PubChem (CID 63908866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).