C13H18N4O2S — CID 63909044
3-(2,6-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine (PubChem CID 63909044) has the molecular formula C13H18N4O2S and a molecular weight of 294.38 g/mol. Its IUPAC name is 3-(2,6-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 3-(2,6-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 63909044 |
| Molecular Formula | C13H18N4O2S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 3-(2,6-dimethylpiperazin-1-yl)sulfonyl-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC1CNCC(C)N1S(=O)(=O)c1c[nH]c2ncccc12 |
| InChI | InChI=1S/C13H18N4O2S/c1-9-6-14-7-10(2)17(9)20(18,19)12-8-16-13-11(12)4-3-5-15-13/h3-5,8-10,14H,6-7H2,1-2H3,(H,15,16) |
| InChIKey | WKJOSWMKFHNDDQ-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |