About 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine
1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine (PubChem CID 63909068) has the molecular formula C12H24N6
and a molecular weight of 252.37 g/mol. Its IUPAC name is 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine |
| PubChem CID | 63909068 |
| Molecular Formula | C12H24N6 |
| Molecular Weight | 252.37 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine |
| SMILES | CCCCn1nnnc1CN1C(C)CNCC1C |
| InChI | InChI=1S/C12H24N6/c1-4-5-6-18-12(14-15-16-18)9-17-10(2)7-13-8-11(17)3/h10-11,13H,4-9H2,1-3H3 |
| InChIKey | AHJNUXXEBNHKQX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.37 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine?
The IUPAC name of 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine (CID 63909068) is 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine.
What is the SMILES notation for 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine?
The canonical SMILES for 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine is CCCCn1nnnc1CN1C(C)CNCC1C.
What is the InChIKey of 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine?
The InChIKey is AHJNUXXEBNHKQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N6/c1-4-5-6-18-12(14-15-16-18)9-17-10(2)7-13-8-11(17)3/h10-11,13H,4-9H2,1-3H3.
What are the key properties of 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine?
1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine has a molecular weight of 252.37 g/mol, XLogP of 0.66, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-butyltetrazol-5-yl)methyl]-2,6-dimethylpiperazine is sourced from PubChem (CID 63909068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).