C14H19BrN2O2 — CID 63909204
(3-bromo-4-methoxyphenyl)-(2,6-dimethylpiperazin-1-yl)methanone (PubChem CID 63909204) has the molecular formula C14H19BrN2O2 and a molecular weight of 327.22 g/mol. Its IUPAC name is (3-bromo-4-methoxyphenyl)-(2,6-dimethylpiperazin-1-yl)methanone.
| Compound Name | (3-bromo-4-methoxyphenyl)-(2,6-dimethylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 63909204 |
| Molecular Formula | C14H19BrN2O2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.06 |
| IUPAC Name | (3-bromo-4-methoxyphenyl)-(2,6-dimethylpiperazin-1-yl)methanone |
| SMILES | COc1ccc(C(=O)N2C(C)CNCC2C)cc1Br |
| InChI | InChI=1S/C14H19BrN2O2/c1-9-7-16-8-10(2)17(9)14(18)11-4-5-13(19-3)12(15)6-11/h4-6,9-10,16H,7-8H2,1-3H3 |
| InChIKey | VFZYWXQRBMOEMG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |