C17H31N3O — CID 63909395
2-cyclopropyl-2-(cyclopropylamino)-3-[methyl-(2-methylcyclohexyl)amino]propanamide (PubChem CID 63909395) has the molecular formula C17H31N3O and a molecular weight of 293.45 g/mol. Its IUPAC name is 2-cyclopropyl-2-(cyclopropylamino)-3-[methyl-(2-methylcyclohexyl)amino]propanamide.
| Compound Name | 2-cyclopropyl-2-(cyclopropylamino)-3-[methyl-(2-methylcyclohexyl)amino]propanamide |
|---|---|
| PubChem CID | 63909395 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 2-cyclopropyl-2-(cyclopropylamino)-3-[methyl-(2-methylcyclohexyl)amino]propanamide |
| SMILES | CC1CCCCC1N(C)CC(NC1CC1)(C(N)=O)C1CC1 |
| InChI | InChI=1S/C17H31N3O/c1-12-5-3-4-6-15(12)20(2)11-17(16(18)21,13-7-8-13)19-14-9-10-14/h12-15,19H,3-11H2,1-2H3,(H2,18,21) |
| InChIKey | TYFWTHARWZJGST-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |