About 1,1-dioxothiane-3-thiol
1,1-dioxothiane-3-thiol (PubChem CID 63909678) has the molecular formula C5H10O2S2
and a molecular weight of 166.27 g/mol. Its IUPAC name is 1,1-dioxothiane-3-thiol.
Molecular Properties
| Compound Name | 1,1-dioxothiane-3-thiol |
| PubChem CID | 63909678 |
| Molecular Formula | C5H10O2S2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.01 |
| IUPAC Name | 1,1-dioxothiane-3-thiol |
| SMILES | O=S1(=O)CCCC(S)C1 |
| InChI | InChI=1S/C5H10O2S2/c6-9(7)3-1-2-5(8)4-9/h5,8H,1-4H2 |
| InChIKey | IGVMTMVYSOTFPA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dioxothiane-3-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dioxothiane-3-thiol?
The IUPAC name of 1,1-dioxothiane-3-thiol (CID 63909678) is 1,1-dioxothiane-3-thiol.
What is the SMILES notation for 1,1-dioxothiane-3-thiol?
The canonical SMILES for 1,1-dioxothiane-3-thiol is O=S1(=O)CCCC(S)C1.
What is the InChIKey of 1,1-dioxothiane-3-thiol?
The InChIKey is IGVMTMVYSOTFPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O2S2/c6-9(7)3-1-2-5(8)4-9/h5,8H,1-4H2.
What are the key properties of 1,1-dioxothiane-3-thiol?
1,1-dioxothiane-3-thiol has a molecular weight of 166.27 g/mol, XLogP of 0.49, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dioxothiane-3-thiol is sourced from PubChem (CID 63909678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).