About 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one
3-[(1,1-dioxothian-3-yl)amino]azepan-2-one (PubChem CID 63910098) has the molecular formula C11H20N2O3S
and a molecular weight of 260.36 g/mol. Its IUPAC name is 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one.
Molecular Properties
| Compound Name | 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one |
| PubChem CID | 63910098 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one |
| SMILES | O=C1NCCCCC1NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H20N2O3S/c14-11-10(5-1-2-6-12-11)13-9-4-3-7-17(15,16)8-9/h9-10,13H,1-8H2,(H,12,14) |
| InChIKey | FNXBAOMAHHCFKY-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one?
The IUPAC name of 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one (CID 63910098) is 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one.
What is the SMILES notation for 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one?
The canonical SMILES for 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one is O=C1NCCCCC1NC1CCCS(=O)(=O)C1.
What is the InChIKey of 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one?
The InChIKey is FNXBAOMAHHCFKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O3S/c14-11-10(5-1-2-6-12-11)13-9-4-3-7-17(15,16)8-9/h9-10,13H,1-8H2,(H,12,14).
What are the key properties of 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one?
3-[(1,1-dioxothian-3-yl)amino]azepan-2-one has a molecular weight of 260.36 g/mol, XLogP of -0.18, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1,1-dioxothian-3-yl)amino]azepan-2-one is sourced from PubChem (CID 63910098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).