About 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine
1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine (PubChem CID 63910226) has the molecular formula C12H20N2O2S2
and a molecular weight of 288.44 g/mol. Its IUPAC name is 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine |
| PubChem CID | 63910226 |
| Molecular Formula | C12H20N2O2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine |
| SMILES | CCc1ccc(S(=O)(=O)N2C(C)CNCC2C)s1 |
| InChI | InChI=1S/C12H20N2O2S2/c1-4-11-5-6-12(17-11)18(15,16)14-9(2)7-13-8-10(14)3/h5-6,9-10,13H,4,7-8H2,1-3H3 |
| InChIKey | QXLZMBYINNFOCT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine?
The IUPAC name of 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine (CID 63910226) is 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine.
What is the SMILES notation for 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine?
The canonical SMILES for 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine is CCc1ccc(S(=O)(=O)N2C(C)CNCC2C)s1.
What is the InChIKey of 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine?
The InChIKey is QXLZMBYINNFOCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O2S2/c1-4-11-5-6-12(17-11)18(15,16)14-9(2)7-13-8-10(14)3/h5-6,9-10,13H,4,7-8H2,1-3H3.
What are the key properties of 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine?
1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine has a molecular weight of 288.44 g/mol, XLogP of 1.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethylthiophen-2-yl)sulfonyl-2,6-dimethylpiperazine is sourced from PubChem (CID 63910226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).