About N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine
N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine (PubChem CID 63910837) has the molecular formula C13H23NO2S
and a molecular weight of 257.40 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine.
Molecular Properties
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine |
| PubChem CID | 63910837 |
| Molecular Formula | C13H23NO2S |
| Molecular Weight | 257.40 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine |
| SMILES | O=S1(=O)CCCC(NCCC2=CCCCC2)C1 |
| InChI | InChI=1S/C13H23NO2S/c15-17(16)10-4-7-13(11-17)14-9-8-12-5-2-1-3-6-12/h5,13-14H,1-4,6-11H2 |
| InChIKey | WKAPLVKMOUTOJV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine?
The IUPAC name of N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine (CID 63910837) is N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine.
What is the SMILES notation for N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine?
The canonical SMILES for N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine is O=S1(=O)CCCC(NCCC2=CCCCC2)C1.
What is the InChIKey of N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine?
The InChIKey is WKAPLVKMOUTOJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23NO2S/c15-17(16)10-4-7-13(11-17)14-9-8-12-5-2-1-3-6-12/h5,13-14H,1-4,6-11H2.
What are the key properties of N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine?
N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine has a molecular weight of 257.40 g/mol, XLogP of 2.04, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(cyclohexen-1-yl)ethyl]-1,1-dioxothian-3-amine is sourced from PubChem (CID 63910837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).