C12H24N2O2 — CID 63910898
2-amino-2-cyclopropyl-3-[methyl(pentyl)amino]propanoic acid (PubChem CID 63910898) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-amino-2-cyclopropyl-3-[methyl(pentyl)amino]propanoic acid.
| Compound Name | 2-amino-2-cyclopropyl-3-[methyl(pentyl)amino]propanoic acid |
|---|---|
| PubChem CID | 63910898 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | 2-amino-2-cyclopropyl-3-[methyl(pentyl)amino]propanoic acid |
| SMILES | CCCCCN(C)CC(N)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C12H24N2O2/c1-3-4-5-8-14(2)9-12(13,11(15)16)10-6-7-10/h10H,3-9,13H2,1-2H3,(H,15,16) |
| InChIKey | MFRNMFBWYCAURJ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|