C16H33N3O2 — CID 63911135
ethyl 2-amino-2-cyclopropyl-3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]propanoate (PubChem CID 63911135) has the molecular formula C16H33N3O2 and a molecular weight of 299.46 g/mol. Its IUPAC name is ethyl 2-amino-2-cyclopropyl-3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]propanoate.
| Compound Name | ethyl 2-amino-2-cyclopropyl-3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]propanoate |
|---|---|
| PubChem CID | 63911135 |
| Molecular Formula | C16H33N3O2 |
| Molecular Weight | 299.46 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | ethyl 2-amino-2-cyclopropyl-3-[2-(dimethylamino)ethyl-(2-methylpropyl)amino]propanoate |
| SMILES | CCOC(=O)C(N)(CN(CCN(C)C)CC(C)C)C1CC1 |
| InChI | InChI=1S/C16H33N3O2/c1-6-21-15(20)16(17,14-7-8-14)12-19(11-13(2)3)10-9-18(4)5/h13-14H,6-12,17H2,1-5H3 |
| InChIKey | WYEDTFXPOZSXRY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.46 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |