About 1-(cyclopentylmethyl)-2,6-dimethylpiperazine
1-(cyclopentylmethyl)-2,6-dimethylpiperazine (PubChem CID 63911622) has the molecular formula C12H24N2
and a molecular weight of 196.34 g/mol. Its IUPAC name is 1-(cyclopentylmethyl)-2,6-dimethylpiperazine.
Molecular Properties
| Compound Name | 1-(cyclopentylmethyl)-2,6-dimethylpiperazine |
| PubChem CID | 63911622 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | 1-(cyclopentylmethyl)-2,6-dimethylpiperazine |
| SMILES | CC1CNCC(C)N1CC1CCCC1 |
| InChI | InChI=1S/C12H24N2/c1-10-7-13-8-11(2)14(10)9-12-5-3-4-6-12/h10-13H,3-9H2,1-2H3 |
| InChIKey | HLTOPUFYVYOIKE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclopentylmethyl)-2,6-dimethylpiperazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopentylmethyl)-2,6-dimethylpiperazine?
The IUPAC name of 1-(cyclopentylmethyl)-2,6-dimethylpiperazine (CID 63911622) is 1-(cyclopentylmethyl)-2,6-dimethylpiperazine.
What is the SMILES notation for 1-(cyclopentylmethyl)-2,6-dimethylpiperazine?
The canonical SMILES for 1-(cyclopentylmethyl)-2,6-dimethylpiperazine is CC1CNCC(C)N1CC1CCCC1.
What is the InChIKey of 1-(cyclopentylmethyl)-2,6-dimethylpiperazine?
The InChIKey is HLTOPUFYVYOIKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2/c1-10-7-13-8-11(2)14(10)9-12-5-3-4-6-12/h10-13H,3-9H2,1-2H3.
What are the key properties of 1-(cyclopentylmethyl)-2,6-dimethylpiperazine?
1-(cyclopentylmethyl)-2,6-dimethylpiperazine has a molecular weight of 196.34 g/mol, XLogP of 1.86, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopentylmethyl)-2,6-dimethylpiperazine is sourced from PubChem (CID 63911622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).