About 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile
2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile (PubChem CID 63912881) has the molecular formula C11H19N3O2S
and a molecular weight of 257.36 g/mol. Its IUPAC name is 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile.
Molecular Properties
| Compound Name | 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile |
| PubChem CID | 63912881 |
| Molecular Formula | C11H19N3O2S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile |
| SMILES | CNC(C#N)(CN1CCS(=O)(=O)CC1)C1CC1 |
| InChI | InChI=1S/C11H19N3O2S/c1-13-11(8-12,10-2-3-10)9-14-4-6-17(15,16)7-5-14/h10,13H,2-7,9H2,1H3 |
| InChIKey | LDYOAUVMOGCCKO-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile?
The IUPAC name of 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile (CID 63912881) is 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile.
What is the SMILES notation for 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile?
The canonical SMILES for 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile is CNC(C#N)(CN1CCS(=O)(=O)CC1)C1CC1.
What is the InChIKey of 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile?
The InChIKey is LDYOAUVMOGCCKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3O2S/c1-13-11(8-12,10-2-3-10)9-14-4-6-17(15,16)7-5-14/h10,13H,2-7,9H2,1H3.
What are the key properties of 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile?
2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile has a molecular weight of 257.36 g/mol, XLogP of -0.39, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-3-(1,1-dioxo-1,4-thiazinan-4-yl)-2-(methylamino)propanenitrile is sourced from PubChem (CID 63912881), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).