About N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine
N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine (PubChem CID 63913422) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine.
Molecular Properties
| Compound Name | N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine |
| PubChem CID | 63913422 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine |
| SMILES | CCN(CC(NC)C1CC1)C1CC1 |
| InChI | InChI=1S/C11H22N2/c1-3-13(10-6-7-10)8-11(12-2)9-4-5-9/h9-12H,3-8H2,1-2H3 |
| InChIKey | APHGQUZVANUJMY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine?
The IUPAC name of N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine (CID 63913422) is N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine.
What is the SMILES notation for N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine?
The canonical SMILES for N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine is CCN(CC(NC)C1CC1)C1CC1.
What is the InChIKey of N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine?
The InChIKey is APHGQUZVANUJMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-3-13(10-6-7-10)8-11(12-2)9-4-5-9/h9-12H,3-8H2,1-2H3.
What are the key properties of N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine?
N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine has a molecular weight of 182.31 g/mol, XLogP of 1.47, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N',1-dicyclopropyl-N'-ethyl-N-methylethane-1,2-diamine is sourced from PubChem (CID 63913422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).