About 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine
1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine (PubChem CID 63913503) has the molecular formula C10H17N3
and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine.
Molecular Properties
| Compound Name | 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine |
| PubChem CID | 63913503 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine |
| SMILES | Cc1cc(C)n(CC(N)C2CC2)n1 |
| InChI | InChI=1S/C10H17N3/c1-7-5-8(2)13(12-7)6-10(11)9-3-4-9/h5,9-10H,3-4,6,11H2,1-2H3 |
| InChIKey | WCYGBYBGMHILLF-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine?
The IUPAC name of 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine (CID 63913503) is 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine.
What is the SMILES notation for 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine?
The canonical SMILES for 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine is Cc1cc(C)n(CC(N)C2CC2)n1.
What is the InChIKey of 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine?
The InChIKey is WCYGBYBGMHILLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3/c1-7-5-8(2)13(12-7)6-10(11)9-3-4-9/h5,9-10H,3-4,6,11H2,1-2H3.
What are the key properties of 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine?
1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine has a molecular weight of 179.27 g/mol, XLogP of 1.24, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-2-(3,5-dimethylpyrazol-1-yl)ethanamine is sourced from PubChem (CID 63913503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).