About N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine
N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine (PubChem CID 63916198) has the molecular formula C13H21N3OS2
and a molecular weight of 299.47 g/mol. Its IUPAC name is N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine.
Molecular Properties
| Compound Name | N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine |
| PubChem CID | 63916198 |
| Molecular Formula | C13H21N3OS2 |
| Molecular Weight | 299.47 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1sc(N2CCS(=O)CC2)nc1C1CC1 |
| InChI | InChI=1S/C13H21N3OS2/c1-2-14-9-11-12(10-3-4-10)15-13(18-11)16-5-7-19(17)8-6-16/h10,14H,2-9H2,1H3 |
| InChIKey | JMYSSTDKIVCGSE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.47 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine?
The IUPAC name of N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine (CID 63916198) is N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine.
What is the SMILES notation for N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine?
The canonical SMILES for N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine is CCNCc1sc(N2CCS(=O)CC2)nc1C1CC1.
What is the InChIKey of N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine?
The InChIKey is JMYSSTDKIVCGSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3OS2/c1-2-14-9-11-12(10-3-4-10)15-13(18-11)16-5-7-19(17)8-6-16/h10,14H,2-9H2,1H3.
What are the key properties of N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine?
N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine has a molecular weight of 299.47 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-cyclopropyl-2-(1-oxo-1,4-thiazinan-4-yl)-1,3-thiazol-5-yl]methyl]ethanamine is sourced from PubChem (CID 63916198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).