About [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine
[4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine (PubChem CID 63916745) has the molecular formula C15H17N3S
and a molecular weight of 271.39 g/mol. Its IUPAC name is [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine.
Molecular Properties
| Compound Name | [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine |
| PubChem CID | 63916745 |
| Molecular Formula | C15H17N3S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine |
| SMILES | NCc1sc(N2CCc3ccccc32)nc1C1CC1 |
| InChI | InChI=1S/C15H17N3S/c16-9-13-14(11-5-6-11)17-15(19-13)18-8-7-10-3-1-2-4-12(10)18/h1-4,11H,5-9,16H2 |
| InChIKey | UDFJXOYKJCKVFI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine?
The IUPAC name of [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine (CID 63916745) is [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine.
What is the SMILES notation for [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine?
The canonical SMILES for [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine is NCc1sc(N2CCc3ccccc32)nc1C1CC1.
What is the InChIKey of [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine?
The InChIKey is UDFJXOYKJCKVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3S/c16-9-13-14(11-5-6-11)17-15(19-13)18-8-7-10-3-1-2-4-12(10)18/h1-4,11H,5-9,16H2.
What are the key properties of [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine?
[4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine has a molecular weight of 271.39 g/mol, XLogP of 3.17, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-cyclopropyl-2-(2,3-dihydroindol-1-yl)-1,3-thiazol-5-yl]methanamine is sourced from PubChem (CID 63916745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).