C12H16N2O2S — CID 63917687
2-cyclopropyl-2-(methylamino)-3-pyridin-2-ylsulfanylpropanoic acid (PubChem CID 63917687) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 2-cyclopropyl-2-(methylamino)-3-pyridin-2-ylsulfanylpropanoic acid.
| Compound Name | 2-cyclopropyl-2-(methylamino)-3-pyridin-2-ylsulfanylpropanoic acid |
|---|---|
| PubChem CID | 63917687 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 2-cyclopropyl-2-(methylamino)-3-pyridin-2-ylsulfanylpropanoic acid |
| SMILES | CNC(CSc1ccccn1)(C(=O)O)C1CC1 |
| InChI | InChI=1S/C12H16N2O2S/c1-13-12(11(15)16,9-5-6-9)8-17-10-4-2-3-7-14-10/h2-4,7,9,13H,5-6,8H2,1H3,(H,15,16) |
| InChIKey | PRTKGBHAAWKSTJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |