About (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine
(NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine (PubChem CID 6391852) has the molecular formula C9H17NOS
and a molecular weight of 187.31 g/mol. Its IUPAC name is (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine |
| PubChem CID | 6391852 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine |
| SMILES | CCC1SC(C)C/C(=N\O)C1C |
| InChI | InChI=1S/C9H17NOS/c1-4-9-7(3)8(10-11)5-6(2)12-9/h6-7,9,11H,4-5H2,1-3H3/b10-8+ |
| InChIKey | YHVCTXUGBPVHTM-CSKARUKUSA-N |
| XLogP | 2.76 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine?
The IUPAC name of (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine (CID 6391852) is (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine.
What is the SMILES notation for (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine?
The canonical SMILES for (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine is CCC1SC(C)C/C(=N\O)C1C.
What is the InChIKey of (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine?
The InChIKey is YHVCTXUGBPVHTM-CSKARUKUSA-N. The full InChI is InChI=1S/C9H17NOS/c1-4-9-7(3)8(10-11)5-6(2)12-9/h6-7,9,11H,4-5H2,1-3H3/b10-8+.
What are the key properties of (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine?
(NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine has a molecular weight of 187.31 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-(2-ethyl-3,6-dimethylthian-4-ylidene)hydroxylamine is sourced from PubChem (CID 6391852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).