C12H23NO4 — CID 63919167
methyl 2-cyclopropyl-3-(2-ethoxyethoxy)-2-(methylamino)propanoate (PubChem CID 63919167) has the molecular formula C12H23NO4 and a molecular weight of 245.32 g/mol. Its IUPAC name is methyl 2-cyclopropyl-3-(2-ethoxyethoxy)-2-(methylamino)propanoate.
| Compound Name | methyl 2-cyclopropyl-3-(2-ethoxyethoxy)-2-(methylamino)propanoate |
|---|---|
| PubChem CID | 63919167 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | methyl 2-cyclopropyl-3-(2-ethoxyethoxy)-2-(methylamino)propanoate |
| SMILES | CCOCCOCC(NC)(C(=O)OC)C1CC1 |
| InChI | InChI=1S/C12H23NO4/c1-4-16-7-8-17-9-12(13-2,10-5-6-10)11(14)15-3/h10,13H,4-9H2,1-3H3 |
| InChIKey | SFSIBDXRVQGQRZ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|