C15H27NO4 — CID 63919336
ethyl 2-cyclopropyl-2-(ethylamino)-3-(oxolan-3-ylmethoxy)propanoate (PubChem CID 63919336) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is ethyl 2-cyclopropyl-2-(ethylamino)-3-(oxolan-3-ylmethoxy)propanoate.
| Compound Name | ethyl 2-cyclopropyl-2-(ethylamino)-3-(oxolan-3-ylmethoxy)propanoate |
|---|---|
| PubChem CID | 63919336 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | ethyl 2-cyclopropyl-2-(ethylamino)-3-(oxolan-3-ylmethoxy)propanoate |
| SMILES | CCNC(COCC1CCOC1)(C(=O)OCC)C1CC1 |
| InChI | InChI=1S/C15H27NO4/c1-3-16-15(13-5-6-13,14(17)20-4-2)11-19-10-12-7-8-18-9-12/h12-13,16H,3-11H2,1-2H3 |
| InChIKey | VOACVNXHKZPLBS-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |