C12H24N2O3 — CID 63919567
2-cyclopropyl-3-(2-methoxyethoxy)-2-(propan-2-ylamino)propanamide (PubChem CID 63919567) has the molecular formula C12H24N2O3 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-cyclopropyl-3-(2-methoxyethoxy)-2-(propan-2-ylamino)propanamide.
| Compound Name | 2-cyclopropyl-3-(2-methoxyethoxy)-2-(propan-2-ylamino)propanamide |
|---|---|
| PubChem CID | 63919567 |
| Molecular Formula | C12H24N2O3 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 2-cyclopropyl-3-(2-methoxyethoxy)-2-(propan-2-ylamino)propanamide |
| SMILES | COCCOCC(NC(C)C)(C(N)=O)C1CC1 |
| InChI | InChI=1S/C12H24N2O3/c1-9(2)14-12(11(13)15,10-4-5-10)8-17-7-6-16-3/h9-10,14H,4-8H2,1-3H3,(H2,13,15) |
| InChIKey | NDNGHNISCZEHIA-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|