C16H21NO4 — CID 63921694
2-cyclopropyl-2-(cyclopropylamino)-3-[4-(hydroxymethyl)phenoxy]propanoic acid (PubChem CID 63921694) has the molecular formula C16H21NO4 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-cyclopropyl-2-(cyclopropylamino)-3-[4-(hydroxymethyl)phenoxy]propanoic acid.
| Compound Name | 2-cyclopropyl-2-(cyclopropylamino)-3-[4-(hydroxymethyl)phenoxy]propanoic acid |
|---|---|
| PubChem CID | 63921694 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-cyclopropyl-2-(cyclopropylamino)-3-[4-(hydroxymethyl)phenoxy]propanoic acid |
| SMILES | O=C(O)C(COc1ccc(CO)cc1)(NC1CC1)C1CC1 |
| InChI | InChI=1S/C16H21NO4/c18-9-11-1-7-14(8-2-11)21-10-16(15(19)20,12-3-4-12)17-13-5-6-13/h1-2,7-8,12-13,17-18H,3-6,9-10H2,(H,19,20) |
| InChIKey | NIGSVHJZPIUOGZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |